C12H15ClN2O3 — CID 82214973
6-[1-chloro-2-[2-hydroxyethyl(methyl)amino]ethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 82214973) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 6-[1-chloro-2-[2-hydroxyethyl(methyl)amino]ethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[1-chloro-2-[2-hydroxyethyl(methyl)amino]ethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82214973 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 6-[1-chloro-2-[2-hydroxyethyl(methyl)amino]ethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CN(CCO)CC(Cl)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-15(4-5-16)7-9(13)8-2-3-10-11(6-8)18-12(17)14-10/h2-3,6,9,16H,4-5,7H2,1H3,(H,14,17) |
| InChIKey | RKDIKTLBDCLHDW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 69.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|