C11H14N2O2 — CID 117043939
6-[methyl(propan-2-yl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 117043939) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 6-[methyl(propan-2-yl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[methyl(propan-2-yl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 117043939 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 6-[methyl(propan-2-yl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CC(C)N(C)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H14N2O2/c1-7(2)13(3)8-4-5-9-10(6-8)15-11(14)12-9/h4-7H,1-3H3,(H,12,14) |
| InChIKey | GGYZWWQOOCLPBS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |