C10H11NO2S — CID 126621176
6-(1-methylsulfanylethyl)-3H-1,3-benzoxazol-2-one (PubChem CID 126621176) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-(1-methylsulfanylethyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-methylsulfanylethyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 126621176 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-(1-methylsulfanylethyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CSC(C)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C10H11NO2S/c1-6(14-2)7-3-4-8-9(5-7)13-10(12)11-8/h3-6H,1-2H3,(H,11,12) |
| InChIKey | AFSJUPRNHHWBHB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |