C11H13NO3 — CID 61089511
6-(1-hydroxybutyl)-3H-1,3-benzoxazol-2-one (PubChem CID 61089511) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 6-(1-hydroxybutyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-hydroxybutyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61089511 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 6-(1-hydroxybutyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CCCC(O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H13NO3/c1-2-3-9(13)7-4-5-8-10(6-7)15-11(14)12-8/h4-6,9,13H,2-3H2,1H3,(H,12,14) |
| InChIKey | PXBSRTAQMDCVCY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |