C10H11NO3S — CID 116831038
5-(1-hydroxy-3-sulfanylpropyl)-3H-1,3-benzoxazol-2-one (PubChem CID 116831038) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 5-(1-hydroxy-3-sulfanylpropyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(1-hydroxy-3-sulfanylpropyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116831038 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 5-(1-hydroxy-3-sulfanylpropyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(C(O)CCS)ccc2o1 |
| InChI | InChI=1S/C10H11NO3S/c12-8(3-4-15)6-1-2-9-7(5-6)11-10(13)14-9/h1-2,5,8,12,15H,3-4H2,(H,11,13) |
| InChIKey | IFDDJXUUMURJEO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|