C9H9BrN2O2 — CID 116961970
5-[bromo(methylamino)methyl]-3H-1,3-benzoxazol-2-one (PubChem CID 116961970) has the molecular formula C9H9BrN2O2 and a molecular weight of 257.09 g/mol. Its IUPAC name is 5-[bromo(methylamino)methyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[bromo(methylamino)methyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116961970 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 5-[bromo(methylamino)methyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CNC(Br)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H9BrN2O2/c1-11-8(10)5-2-3-7-6(4-5)12-9(13)14-7/h2-4,8,11H,1H3,(H,12,13) |
| InChIKey | BPUSOTOTQXKLAT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|