C13H16N2O4 — CID 116946022
methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate (PubChem CID 116946022) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate.
| Compound Name | methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate |
|---|---|
| PubChem CID | 116946022 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate |
| SMILES | CCC(C(=O)OC)C(N)c1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H16N2O4/c1-3-8(12(16)18-2)11(14)7-4-5-10-9(6-7)15-13(17)19-10/h4-6,8,11H,3,14H2,1-2H3,(H,15,17) |
| InChIKey | RXAIQAPJSPRGIZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |