methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate

C13H16N2O4 — CID 116946022

IUPACmethyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate
SMILESCCC(C(=O)OC)C(N)c1ccc2oc(=O)[nH]c2c1
InChIInChI=1S/C13H16N2O4/c1-3-8(12(16)18-2)11(14)7-4-5-10-9(6-7)15-13(17)19-10/h4-6,8,11H,3,14H2,1-2H3,(H,15,17)
InChIKeyRXAIQAPJSPRGIZ-UHFFFAOYSA-N
MW264.28 g/mol
LogP1.32
Rot. Bonds4

About methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate

methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate (PubChem CID 116946022) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate.

Molecular Properties

Compound Namemethyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate
PubChem CID116946022
Molecular FormulaC13H16N2O4
Molecular Weight264.28 g/mol
Exact Mass264.11
IUPAC Namemethyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate
SMILESCCC(C(=O)OC)C(N)c1ccc2oc(=O)[nH]c2c1
InChIInChI=1S/C13H16N2O4/c1-3-8(12(16)18-2)11(14)7-4-5-10-9(6-7)15-13(17)19-10/h4-6,8,11H,3,14H2,1-2H3,(H,15,17)
InChIKeyRXAIQAPJSPRGIZ-UHFFFAOYSA-N
XLogP1.32
TPSA98.32 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 51.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate?
The IUPAC name of methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate (CID 116946022) is methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate.
What is the SMILES notation for methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate?
The canonical SMILES for methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate is CCC(C(=O)OC)C(N)c1ccc2oc(=O)[nH]c2c1.
What is the InChIKey of methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate?
The InChIKey is RXAIQAPJSPRGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4/c1-3-8(12(16)18-2)11(14)7-4-5-10-9(6-7)15-13(17)19-10/h4-6,8,11H,3,14H2,1-2H3,(H,15,17).
What are the key properties of methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate?
methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate has a molecular weight of 264.28 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[amino-(2-oxo-3H-1,3-benzoxazol-5-yl)methyl]butanoate is sourced from PubChem (CID 116946022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).