C11H11NO6 — CID 171877904
3,4-dihydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid (PubChem CID 171877904) has the molecular formula C11H11NO6 and a molecular weight of 253.21 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid.
| Compound Name | 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid |
|---|---|
| PubChem CID | 171877904 |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 3,4-dihydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H11NO6/c13-7(4-9(14)15)10(16)5-1-2-6-8(3-5)18-11(17)12-6/h1-3,7,10,13,16H,4H2,(H,12,17)(H,14,15) |
| InChIKey | VKECFBPYHHWLCW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |