C11H12N2O5 — CID 82348543
3-amino-4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid (PubChem CID 82348543) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 3-amino-4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid.
| Compound Name | 3-amino-4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid |
|---|---|
| PubChem CID | 82348543 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 3-amino-4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)butanoic acid |
| SMILES | NC(CC(=O)O)C(O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C11H12N2O5/c12-6(4-9(14)15)10(16)5-1-2-7-8(3-5)18-11(17)13-7/h1-3,6,10,16H,4,12H2,(H,13,17)(H,14,15) |
| InChIKey | KOTSXQXHKGFKOL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |