C14H16N2O5 — CID 82348540
4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-(prop-2-enylamino)butanoic acid (PubChem CID 82348540) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-(prop-2-enylamino)butanoic acid.
| Compound Name | 4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-(prop-2-enylamino)butanoic acid |
|---|---|
| PubChem CID | 82348540 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-hydroxy-4-(2-oxo-3H-1,3-benzoxazol-6-yl)-3-(prop-2-enylamino)butanoic acid |
| SMILES | C=CCNC(CC(=O)O)C(O)c1ccc2[nH]c(=O)oc2c1 |
| InChI | InChI=1S/C14H16N2O5/c1-2-5-15-10(7-12(17)18)13(19)8-3-4-9-11(6-8)21-14(20)16-9/h2-4,6,10,13,15,19H,1,5,7H2,(H,16,20)(H,17,18) |
| InChIKey | HLMZEYWKGBQUFP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|