C17H25NO3 — CID 82349217
4-hydroxy-3-(prop-2-enylamino)-4-(2,3,5,6-tetramethylphenyl)butanoic acid (PubChem CID 82349217) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-hydroxy-3-(prop-2-enylamino)-4-(2,3,5,6-tetramethylphenyl)butanoic acid.
| Compound Name | 4-hydroxy-3-(prop-2-enylamino)-4-(2,3,5,6-tetramethylphenyl)butanoic acid |
|---|---|
| PubChem CID | 82349217 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 4-hydroxy-3-(prop-2-enylamino)-4-(2,3,5,6-tetramethylphenyl)butanoic acid |
| SMILES | C=CCNC(CC(=O)O)C(O)c1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C17H25NO3/c1-6-7-18-14(9-15(19)20)17(21)16-12(4)10(2)8-11(3)13(16)5/h6,8,14,17-18,21H,1,7,9H2,2-5H3,(H,19,20) |
| InChIKey | MMKHHHGTYWLXJJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|