C17H25NO3 — CID 82347684
methyl 5-(3,4-dimethylphenyl)-5-hydroxy-4-(prop-2-enylamino)pentanoate (PubChem CID 82347684) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl 5-(3,4-dimethylphenyl)-5-hydroxy-4-(prop-2-enylamino)pentanoate.
| Compound Name | methyl 5-(3,4-dimethylphenyl)-5-hydroxy-4-(prop-2-enylamino)pentanoate |
|---|---|
| PubChem CID | 82347684 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | methyl 5-(3,4-dimethylphenyl)-5-hydroxy-4-(prop-2-enylamino)pentanoate |
| SMILES | C=CCNC(CCC(=O)OC)C(O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-5-10-18-15(8-9-16(19)21-4)17(20)14-7-6-12(2)13(3)11-14/h5-7,11,15,17-18,20H,1,8-10H2,2-4H3 |
| InChIKey | GSZMGHAWORXQHF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|