C15H21NO2 — CID 62352914
ethyl 2-(3,4-dimethylphenyl)-2-(prop-2-enylamino)acetate (PubChem CID 62352914) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is ethyl 2-(3,4-dimethylphenyl)-2-(prop-2-enylamino)acetate.
| Compound Name | ethyl 2-(3,4-dimethylphenyl)-2-(prop-2-enylamino)acetate |
|---|---|
| PubChem CID | 62352914 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | ethyl 2-(3,4-dimethylphenyl)-2-(prop-2-enylamino)acetate |
| SMILES | C=CCNC(C(=O)OCC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H21NO2/c1-5-9-16-14(15(17)18-6-2)13-8-7-11(3)12(4)10-13/h5,7-8,10,14,16H,1,6,9H2,2-4H3 |
| InChIKey | RGXBXUQYSJKOAQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|