C13H16BrNO2 — CID 62352919
ethyl 2-(3-bromophenyl)-2-(prop-2-enylamino)acetate (PubChem CID 62352919) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is ethyl 2-(3-bromophenyl)-2-(prop-2-enylamino)acetate.
| Compound Name | ethyl 2-(3-bromophenyl)-2-(prop-2-enylamino)acetate |
|---|---|
| PubChem CID | 62352919 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | ethyl 2-(3-bromophenyl)-2-(prop-2-enylamino)acetate |
| SMILES | C=CCNC(C(=O)OCC)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrNO2/c1-3-8-15-12(13(16)17-4-2)10-6-5-7-11(14)9-10/h3,5-7,9,12,15H,1,4,8H2,2H3 |
| InChIKey | DDDQTIMQFZGYBX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|