C14H18BrNO2 — CID 103257333
ethyl 2-[[[(1R)-1-(3-bromophenyl)ethyl]amino]methyl]prop-2-enoate (PubChem CID 103257333) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is ethyl 2-[[[(1R)-1-(3-bromophenyl)ethyl]amino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[[(1R)-1-(3-bromophenyl)ethyl]amino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103257333 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | ethyl 2-[[[(1R)-1-(3-bromophenyl)ethyl]amino]methyl]prop-2-enoate |
| SMILES | C=C(CN[C@H](C)c1cccc(Br)c1)C(=O)OCC |
| InChI | InChI=1S/C14H18BrNO2/c1-4-18-14(17)10(2)9-16-11(3)12-6-5-7-13(15)8-12/h5-8,11,16H,2,4,9H2,1,3H3/t11-/m1/s1 |
| InChIKey | DNRYLNKQBFTCMZ-LLVKDONJSA-N |
| XLogP | 3.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|