C13H18N2O2 — CID 103258974
ethyl 2-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]prop-2-enoate (PubChem CID 103258974) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is ethyl 2-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103258974 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | ethyl 2-[[[(1R)-1-pyridin-4-ylethyl]amino]methyl]prop-2-enoate |
| SMILES | C=C(CN[C@H](C)c1ccncc1)C(=O)OCC |
| InChI | InChI=1S/C13H18N2O2/c1-4-17-13(16)10(2)9-15-11(3)12-5-7-14-8-6-12/h5-8,11,15H,2,4,9H2,1,3H3/t11-/m1/s1 |
| InChIKey | USLGDRVAHWVAOG-LLVKDONJSA-N |
| XLogP | 1.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|