C18H21BrClNO2 — CID 172883091
ethyl 2-[[[(1S)-1-(3-bromophenyl)ethyl]amino]methyl]benzoate;hydrochloride (PubChem CID 172883091) has the molecular formula C18H21BrClNO2 and a molecular weight of 398.73 g/mol. Its IUPAC name is ethyl 2-[[[(1S)-1-(3-bromophenyl)ethyl]amino]methyl]benzoate;hydrochloride.
| Compound Name | ethyl 2-[[[(1S)-1-(3-bromophenyl)ethyl]amino]methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 172883091 |
| Molecular Formula | C18H21BrClNO2 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | ethyl 2-[[[(1S)-1-(3-bromophenyl)ethyl]amino]methyl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccccc1CN[C@@H](C)c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C18H20BrNO2.ClH/c1-3-22-18(21)17-10-5-4-7-15(17)12-20-13(2)14-8-6-9-16(19)11-14;/h4-11,13,20H,3,12H2,1-2H3;1H/t13-;/m0./s1 |
| InChIKey | VXJXXROEDYMCKC-ZOWNYOTGSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |