C13H18ClNO3 — CID 82347944
methyl 5-(4-chlorophenyl)-5-hydroxy-4-(methylamino)pentanoate (PubChem CID 82347944) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is methyl 5-(4-chlorophenyl)-5-hydroxy-4-(methylamino)pentanoate.
| Compound Name | methyl 5-(4-chlorophenyl)-5-hydroxy-4-(methylamino)pentanoate |
|---|---|
| PubChem CID | 82347944 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | methyl 5-(4-chlorophenyl)-5-hydroxy-4-(methylamino)pentanoate |
| SMILES | CNC(CCC(=O)OC)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO3/c1-15-11(7-8-12(16)18-2)13(17)9-3-5-10(14)6-4-9/h3-6,11,13,15,17H,7-8H2,1-2H3 |
| InChIKey | LUVINCGRYDQBRZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |