C11H14ClNO3 — CID 82347914
methyl 3-amino-4-(4-chlorophenyl)-4-hydroxybutanoate (PubChem CID 82347914) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is methyl 3-amino-4-(4-chlorophenyl)-4-hydroxybutanoate.
| Compound Name | methyl 3-amino-4-(4-chlorophenyl)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 82347914 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | methyl 3-amino-4-(4-chlorophenyl)-4-hydroxybutanoate |
| SMILES | COC(=O)CC(N)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO3/c1-16-10(14)6-9(13)11(15)7-2-4-8(12)5-3-7/h2-5,9,11,15H,6,13H2,1H3 |
| InChIKey | ITTPALBXDAAUBI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |