C12H17NO4 — CID 82348360
methyl 3-amino-4-hydroxy-4-(4-methoxyphenyl)butanoate (PubChem CID 82348360) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is methyl 3-amino-4-hydroxy-4-(4-methoxyphenyl)butanoate.
| Compound Name | methyl 3-amino-4-hydroxy-4-(4-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 82348360 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | methyl 3-amino-4-hydroxy-4-(4-methoxyphenyl)butanoate |
| SMILES | COC(=O)CC(N)C(O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H17NO4/c1-16-9-5-3-8(4-6-9)12(15)10(13)7-11(14)17-2/h3-6,10,12,15H,7,13H2,1-2H3 |
| InChIKey | XTOWICKMPRGVEW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |