C13H19NO5 — CID 82348525
methyl 3-amino-4-(3,4-dimethoxyphenyl)-4-hydroxybutanoate (PubChem CID 82348525) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 3-amino-4-(3,4-dimethoxyphenyl)-4-hydroxybutanoate.
| Compound Name | methyl 3-amino-4-(3,4-dimethoxyphenyl)-4-hydroxybutanoate |
|---|---|
| PubChem CID | 82348525 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 3-amino-4-(3,4-dimethoxyphenyl)-4-hydroxybutanoate |
| SMILES | COC(=O)CC(N)C(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H19NO5/c1-17-10-5-4-8(6-11(10)18-2)13(16)9(14)7-12(15)19-3/h4-6,9,13,16H,7,14H2,1-3H3 |
| InChIKey | IGUFJYQJQGOEFS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |