C18H22O6 — CID 11461770
1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-diol (PubChem CID 11461770) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-diol.
| Compound Name | 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 11461770 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C18H22O6/c1-21-13-7-5-11(9-15(13)23-3)17(19)18(20)12-6-8-14(22-2)16(10-12)24-4/h5-10,17-20H,1-4H3 |
| InChIKey | MZNPNSXBQAJKBM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |