C15H16O3 — CID 7154230
(S)-(3,4-dimethoxyphenyl)-phenylmethanol (PubChem CID 7154230) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (S)-(3,4-dimethoxyphenyl)-phenylmethanol.
| Compound Name | (S)-(3,4-dimethoxyphenyl)-phenylmethanol |
|---|---|
| PubChem CID | 7154230 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (S)-(3,4-dimethoxyphenyl)-phenylmethanol |
| SMILES | COc1ccc([C@@H](O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C15H16O3/c1-17-13-9-8-12(10-14(13)18-2)15(16)11-6-4-3-5-7-11/h3-10,15-16H,1-2H3/t15-/m0/s1 |
| InChIKey | YUSIFTKKBCLPAD-HNNXBMFYSA-N |
| XLogP | 2.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |