C29H30O3P+ — CID 11284069
[3-(3,4-dimethoxyphenyl)-3-hydroxypropyl]-triphenylphosphanium (PubChem CID 11284069) has the molecular formula C29H30O3P+ and a molecular weight of 457.53 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-3-hydroxypropyl]-triphenylphosphanium.
| Compound Name | [3-(3,4-dimethoxyphenyl)-3-hydroxypropyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 11284069 |
| Molecular Formula | C29H30O3P+ |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-3-hydroxypropyl]-triphenylphosphanium |
| SMILES | COc1ccc(C(O)CC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H30O3P/c1-31-28-19-18-23(22-29(28)32-2)27(30)20-21-33(24-12-6-3-7-13-24,25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-19,22,27,30H,20-21H2,1-2H3/q+1 |
| InChIKey | LNCVJTRRKCADQK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|