C18H23NO3 — CID 82073662
1-(3,4-dimethoxyphenyl)-3-(N-methylanilino)propan-1-ol (PubChem CID 82073662) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(N-methylanilino)propan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(N-methylanilino)propan-1-ol |
|---|---|
| PubChem CID | 82073662 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(N-methylanilino)propan-1-ol |
| SMILES | COc1ccc(C(O)CCN(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H23NO3/c1-19(15-7-5-4-6-8-15)12-11-16(20)14-9-10-17(21-2)18(13-14)22-3/h4-10,13,16,20H,11-12H2,1-3H3 |
| InChIKey | HZTJLPURAJSAKT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |