C14H21NO5 — CID 82348535
methyl 4-amino-5-(3,4-dimethoxyphenyl)-5-hydroxypentanoate (PubChem CID 82348535) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl 4-amino-5-(3,4-dimethoxyphenyl)-5-hydroxypentanoate.
| Compound Name | methyl 4-amino-5-(3,4-dimethoxyphenyl)-5-hydroxypentanoate |
|---|---|
| PubChem CID | 82348535 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 4-amino-5-(3,4-dimethoxyphenyl)-5-hydroxypentanoate |
| SMILES | COC(=O)CCC(N)C(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21NO5/c1-18-11-6-4-9(8-12(11)19-2)14(17)10(15)5-7-13(16)20-3/h4,6,8,10,14,17H,5,7,15H2,1-3H3 |
| InChIKey | NPBXLQTVJSYPBS-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |