C17H26N2O5 — CID 120559435
methyl 3-(4-aminopentanoylamino)-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 120559435) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl 3-(4-aminopentanoylamino)-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl 3-(4-aminopentanoylamino)-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 120559435 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | methyl 3-(4-aminopentanoylamino)-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)CCC(C)N)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O5/c1-11(18)5-8-16(20)19-13(10-17(21)24-4)12-6-7-14(22-2)15(9-12)23-3/h6-7,9,11,13H,5,8,10,18H2,1-4H3,(H,19,20) |
| InChIKey | BDYSFVMHTPAYFH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |