C23H27ClN2O6 — CID 46657480
methyl 3-[4-[(4-chlorobenzoyl)amino]butanoylamino]-3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 46657480) has the molecular formula C23H27ClN2O6 and a molecular weight of 462.93 g/mol. Its IUPAC name is methyl 3-[4-[(4-chlorobenzoyl)amino]butanoylamino]-3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | methyl 3-[4-[(4-chlorobenzoyl)amino]butanoylamino]-3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 46657480 |
| Molecular Formula | C23H27ClN2O6 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | methyl 3-[4-[(4-chlorobenzoyl)amino]butanoylamino]-3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)CCCNC(=O)c1ccc(Cl)cc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H27ClN2O6/c1-30-19-11-8-16(13-20(19)31-2)18(14-22(28)32-3)26-21(27)5-4-12-25-23(29)15-6-9-17(24)10-7-15/h6-11,13,18H,4-5,12,14H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | BXUCFTZVPCXMOG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|