C23H30N2O7 — CID 46697929
methyl 3-(3,4-dimethoxyphenyl)-3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]propanoate (PubChem CID 46697929) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is methyl 3-(3,4-dimethoxyphenyl)-3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]propanoate.
| Compound Name | methyl 3-(3,4-dimethoxyphenyl)-3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 46697929 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | methyl 3-(3,4-dimethoxyphenyl)-3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CCN1C(=O)C2CCCCC2C1=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H30N2O7/c1-30-18-9-8-14(12-19(18)31-2)17(13-21(27)32-3)24-20(26)10-11-25-22(28)15-6-4-5-7-16(15)23(25)29/h8-9,12,15-17H,4-7,10-11,13H2,1-3H3,(H,24,26) |
| InChIKey | ZXTVZMIARWWYDC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|