C20H25N3O5 — CID 2641877
3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-acetamido-2-methoxyphenyl)propanamide (PubChem CID 2641877) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-acetamido-2-methoxyphenyl)propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-acetamido-2-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2641877 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(5-acetamido-2-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C20H25N3O5/c1-12(24)21-13-7-8-17(28-2)16(11-13)22-18(25)9-10-23-19(26)14-5-3-4-6-15(14)20(23)27/h7-8,11,14-15H,3-6,9-10H2,1-2H3,(H,21,24)(H,22,25)/t14-,15-/m0/s1 |
| InChIKey | HFCDWDXZMRDIHY-GJZGRUSLSA-N |
| XLogP | 2.16 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|