C22H27N3O4 — CID 55711571
N-[3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-4-methylphenyl]cyclopropanecarboxamide (PubChem CID 55711571) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-4-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-4-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55711571 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[3-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-4-methylphenyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC2)cc1NC(=O)CCN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C22H27N3O4/c1-13-6-9-15(23-20(27)14-7-8-14)12-18(13)24-19(26)10-11-25-21(28)16-4-2-3-5-17(16)22(25)29/h6,9,12,14,16-17H,2-5,7-8,10-11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | AZYMNMWQCRXFMZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|