C19H23N3O4 — CID 98366787
4-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-methylbenzamide (PubChem CID 98366787) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-methylbenzamide.
| Compound Name | 4-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-methylbenzamide |
|---|---|
| PubChem CID | 98366787 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 4-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1NC(=O)CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C19H23N3O4/c1-11-10-12(17(20)24)6-7-15(11)21-16(23)8-9-22-18(25)13-4-2-3-5-14(13)19(22)26/h6-7,10,13-14H,2-5,8-9H2,1H3,(H2,20,24)(H,21,23)/t13-,14-/m0/s1 |
| InChIKey | ATETYKVGKKMLAB-KBPBESRZSA-N |
| XLogP | 1.60 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|