C19H25N3O5S — CID 9107009
3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-methyl-3-(methylsulfamoyl)phenyl]propanamide (PubChem CID 9107009) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-methyl-3-(methylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-methyl-3-(methylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 9107009 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[4-methyl-3-(methylsulfamoyl)phenyl]propanamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)CCN2C(=O)[C@H]3CCCC[C@@H]3C2=O)ccc1C |
| InChI | InChI=1S/C19H25N3O5S/c1-12-7-8-13(11-16(12)28(26,27)20-2)21-17(23)9-10-22-18(24)14-5-3-4-6-15(14)19(22)25/h7-8,11,14-15,20H,3-6,9-10H2,1-2H3,(H,21,23)/t14-,15-/m0/s1 |
| InChIKey | BCLBGZHPKWJGDQ-GJZGRUSLSA-N |
| XLogP | 1.41 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|