C23H32N2O5 — CID 11928712
3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]propanamide (PubChem CID 11928712) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 11928712 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[(1S)-1-(3,4-diethoxyphenyl)ethyl]propanamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)CCN2C(=O)[C@H]3CCCC[C@@H]3C2=O)cc1OCC |
| InChI | InChI=1S/C23H32N2O5/c1-4-29-19-11-10-16(14-20(19)30-5-2)15(3)24-21(26)12-13-25-22(27)17-8-6-7-9-18(17)23(25)28/h10-11,14-15,17-18H,4-9,12-13H2,1-3H3,(H,24,26)/t15-,17-,18-/m0/s1 |
| InChIKey | QSWFBNJXSGZCBK-SZMVWBNQSA-N |
| XLogP | 3.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|