C16H21F3N2O4 — CID 120560793
methyl 3-(4-aminopentanoylamino)-3-[4-(trifluoromethoxy)phenyl]propanoate (PubChem CID 120560793) has the molecular formula C16H21F3N2O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is methyl 3-(4-aminopentanoylamino)-3-[4-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl 3-(4-aminopentanoylamino)-3-[4-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 120560793 |
| Molecular Formula | C16H21F3N2O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | methyl 3-(4-aminopentanoylamino)-3-[4-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)CC(NC(=O)CCC(C)N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O4/c1-10(20)3-8-14(22)21-13(9-15(23)24-2)11-4-6-12(7-5-11)25-16(17,18)19/h4-7,10,13H,3,8-9,20H2,1-2H3,(H,21,22) |
| InChIKey | JBBWZOPZLRNZKO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |