C13H14F4N2O4 — CID 166849593
methyl (3S)-3-[(2-aminoacetyl)amino]-3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoate (PubChem CID 166849593) has the molecular formula C13H14F4N2O4 and a molecular weight of 338.26 g/mol. Its IUPAC name is methyl (3S)-3-[(2-aminoacetyl)amino]-3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoate.
| Compound Name | methyl (3S)-3-[(2-aminoacetyl)amino]-3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 166849593 |
| Molecular Formula | C13H14F4N2O4 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | methyl (3S)-3-[(2-aminoacetyl)amino]-3-[4-fluoro-3-(trifluoromethoxy)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)CN)c1ccc(F)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F4N2O4/c1-22-12(21)5-9(19-11(20)6-18)7-2-3-8(14)10(4-7)23-13(15,16)17/h2-4,9H,5-6,18H2,1H3,(H,19,20)/t9-/m0/s1 |
| InChIKey | ZYWWNKYHRVKWCK-VIFPVBQESA-N |
| XLogP | 1.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |