C14H17F3N2O4 — CID 166849504
methyl (3S)-3-[(2-aminoacetyl)amino]-3-[3-methoxy-5-(trifluoromethyl)phenyl]propanoate (PubChem CID 166849504) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is methyl (3S)-3-[(2-aminoacetyl)amino]-3-[3-methoxy-5-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (3S)-3-[(2-aminoacetyl)amino]-3-[3-methoxy-5-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 166849504 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl (3S)-3-[(2-aminoacetyl)amino]-3-[3-methoxy-5-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)CN)c1cc(OC)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O4/c1-22-10-4-8(3-9(5-10)14(15,16)17)11(6-13(21)23-2)19-12(20)7-18/h3-5,11H,6-7,18H2,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | JUTJMQUTYKCBNH-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |