C14H13F6NO4 — CID 86603441
methyl 3-[3,5-bis(trifluoromethyl)phenyl]-4-nitropentanoate (PubChem CID 86603441) has the molecular formula C14H13F6NO4 and a molecular weight of 373.25 g/mol. Its IUPAC name is methyl 3-[3,5-bis(trifluoromethyl)phenyl]-4-nitropentanoate.
| Compound Name | methyl 3-[3,5-bis(trifluoromethyl)phenyl]-4-nitropentanoate |
|---|---|
| PubChem CID | 86603441 |
| Molecular Formula | C14H13F6NO4 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | methyl 3-[3,5-bis(trifluoromethyl)phenyl]-4-nitropentanoate |
| SMILES | COC(=O)CC(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F6NO4/c1-7(21(23)24)11(6-12(22)25-2)8-3-9(13(15,16)17)5-10(4-8)14(18,19)20/h3-5,7,11H,6H2,1-2H3 |
| InChIKey | REZQKBMLTHGZHS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|