C16H14F6O5 — CID 134957298
dimethyl 2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxopropyl]propanedioate (PubChem CID 134957298) has the molecular formula C16H14F6O5 and a molecular weight of 400.27 g/mol. Its IUPAC name is dimethyl 2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxopropyl]propanedioate.
| Compound Name | dimethyl 2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxopropyl]propanedioate |
|---|---|
| PubChem CID | 134957298 |
| Molecular Formula | C16H14F6O5 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | dimethyl 2-[(1S)-1-[3,5-bis(trifluoromethyl)phenyl]-3-oxopropyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](CC=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F6O5/c1-26-13(24)12(14(25)27-2)11(3-4-23)8-5-9(15(17,18)19)7-10(6-8)16(20,21)22/h4-7,11-12H,3H2,1-2H3/t11-/m1/s1 |
| InChIKey | MHZLQCHRYZUEKM-LLVKDONJSA-N |
| XLogP | 3.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|