C12H11F6NO2 — CID 79015790
ethyl 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]acetate (PubChem CID 79015790) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is ethyl 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 79015790 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | ethyl 2-amino-2-[3,5-bis(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO2/c1-2-21-10(20)9(19)6-3-7(11(13,14)15)5-8(4-6)12(16,17)18/h3-5,9H,2,19H2,1H3 |
| InChIKey | GYNAQYKIVFPKJB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |