C11H11F6N — CID 18543623
1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine (PubChem CID 18543623) has the molecular formula C11H11F6N and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 18543623 |
| Molecular Formula | C11H11F6N |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]propan-1-amine |
| SMILES | CCC(N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F6N/c1-2-9(18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h3-5,9H,2,18H2,1H3 |
| InChIKey | JDBPNFXZESJTAH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |