C11H12F6N2 — CID 124633832
[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]propyl]hydrazine (PubChem CID 124633832) has the molecular formula C11H12F6N2 and a molecular weight of 286.22 g/mol. Its IUPAC name is [(1R)-1-[3,5-bis(trifluoromethyl)phenyl]propyl]hydrazine.
| Compound Name | [(1R)-1-[3,5-bis(trifluoromethyl)phenyl]propyl]hydrazine |
|---|---|
| PubChem CID | 124633832 |
| Molecular Formula | C11H12F6N2 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | [(1R)-1-[3,5-bis(trifluoromethyl)phenyl]propyl]hydrazine |
| SMILES | CC[C@@H](NN)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F6N2/c1-2-9(19-18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h3-5,9,19H,2,18H2,1H3/t9-/m1/s1 |
| InChIKey | INDPVIFLKGYXEG-SECBINFHSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|