C10H10F4O — CID 97294480
(1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 97294480) has the molecular formula C10H10F4O and a molecular weight of 222.18 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | (1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 97294480 |
| Molecular Formula | C10H10F4O |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F4O/c1-2-9(15)6-3-7(10(12,13)14)5-8(11)4-6/h3-5,9,15H,2H2,1H3/t9-/m1/s1 |
| InChIKey | KBEYZUQUEAEYIJ-SECBINFHSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |