C11H12F4O3S — CID 115351041
1-[3-fluoro-5-(trifluoromethyl)phenyl]-3-methylsulfonylpropan-1-ol (PubChem CID 115351041) has the molecular formula C11H12F4O3S and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-[3-fluoro-5-(trifluoromethyl)phenyl]-3-methylsulfonylpropan-1-ol.
| Compound Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-3-methylsulfonylpropan-1-ol |
|---|---|
| PubChem CID | 115351041 |
| Molecular Formula | C11H12F4O3S |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]-3-methylsulfonylpropan-1-ol |
| SMILES | CS(=O)(=O)CCC(O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4O3S/c1-19(17,18)3-2-10(16)7-4-8(11(13,14)15)6-9(12)5-7/h4-6,10,16H,2-3H2,1H3 |
| InChIKey | JEUZOQUGKIASOW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |