C11H12F4O — CID 97294442
(1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 97294442) has the molecular formula C11H12F4O and a molecular weight of 236.21 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | (1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 97294442 |
| Molecular Formula | C11H12F4O |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | (1R)-1-[3-fluoro-5-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CCC[C@@H](O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4O/c1-2-3-10(16)7-4-8(11(13,14)15)6-9(12)5-7/h4-6,10,16H,2-3H2,1H3/t10-/m1/s1 |
| InChIKey | YLPOAPDCIXWPRL-SNVBAGLBSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |