C12H16F2O — CID 62608438
1-(3,5-difluorophenyl)hexan-1-ol (PubChem CID 62608438) has the molecular formula C12H16F2O and a molecular weight of 214.26 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)hexan-1-ol.
| Compound Name | 1-(3,5-difluorophenyl)hexan-1-ol |
|---|---|
| PubChem CID | 62608438 |
| Molecular Formula | C12H16F2O |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(3,5-difluorophenyl)hexan-1-ol |
| SMILES | CCCCCC(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2O/c1-2-3-4-5-12(15)9-6-10(13)8-11(14)7-9/h6-8,12,15H,2-5H2,1H3 |
| InChIKey | BCFINVMKOVWWJF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|