C9H9ClF2O — CID 146430638
(1R)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol (PubChem CID 146430638) has the molecular formula C9H9ClF2O and a molecular weight of 206.62 g/mol. Its IUPAC name is (1R)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol.
| Compound Name | (1R)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 146430638 |
| Molecular Formula | C9H9ClF2O |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (1R)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol |
| SMILES | O[C@H](CCCl)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H9ClF2O/c10-2-1-9(13)6-3-7(11)5-8(12)4-6/h3-5,9,13H,1-2H2/t9-/m1/s1 |
| InChIKey | GCWYIIPGPAMLFZ-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|