C9H10F2O2 — CID 62791322
1-(3,5-difluorophenyl)-2-methoxyethanol (PubChem CID 62791322) has the molecular formula C9H10F2O2 and a molecular weight of 188.17 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-methoxyethanol.
| Compound Name | 1-(3,5-difluorophenyl)-2-methoxyethanol |
|---|---|
| PubChem CID | 62791322 |
| Molecular Formula | C9H10F2O2 |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-methoxyethanol |
| SMILES | COCC(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H10F2O2/c1-13-5-9(12)6-2-7(10)4-8(11)3-6/h2-4,9,12H,5H2,1H3 |
| InChIKey | YJBFEWITUVCJOG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |