C12H18O5 — CID 79566976
2-methoxy-1-(3,4,5-trimethoxyphenyl)ethanol (PubChem CID 79566976) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-methoxy-1-(3,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 2-methoxy-1-(3,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 79566976 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-methoxy-1-(3,4,5-trimethoxyphenyl)ethanol |
| SMILES | COCC(O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H18O5/c1-14-7-9(13)8-5-10(15-2)12(17-4)11(6-8)16-3/h5-6,9,13H,7H2,1-4H3 |
| InChIKey | OQWHEUVMVJQYDS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |