C11H16O4S — CID 116830062
2-sulfanyl-1-(3,4,5-trimethoxyphenyl)ethanol (PubChem CID 116830062) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is 2-sulfanyl-1-(3,4,5-trimethoxyphenyl)ethanol.
| Compound Name | 2-sulfanyl-1-(3,4,5-trimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 116830062 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-sulfanyl-1-(3,4,5-trimethoxyphenyl)ethanol |
| SMILES | COc1cc(C(O)CS)cc(OC)c1OC |
| InChI | InChI=1S/C11H16O4S/c1-13-9-4-7(8(12)6-16)5-10(14-2)11(9)15-3/h4-5,8,12,16H,6H2,1-3H3 |
| InChIKey | JEPLDYVCSLFFLA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|